Products 950045-04-2
CAS 950045-04-2 is the registry number for N-(3-chloro-4-cyanophenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3-chloro-4-cyanophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 950045-04-2) is a chemical compound with the molecular formula C19H17ClN2O and a molecular weight of 324.8 g/mol. IUPAC name: N-(3-chloro-4-cyanophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: DTQACYWSHGZFEE-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | N-(3-chloro-4-cyanophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | DTQACYWSHGZFEE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC(=C(C=C3)C#N)Cl |
Computed by PubChem (NCBI)