Products 119411-70-0
CAS 119411-70-0 is the registry number for 4-(2,6-Dichlorophenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 1000mg.
4-(2,6-dichlorophenoxy)butanoic acid (CAS 119411-70-0) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: 4-(2,6-dichlorophenoxy)butanoic acid. InChIKey: WJYHXANOKSWCLH-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 4-(2,6-dichlorophenoxy)butanoic acid |
| InChIKey | WJYHXANOKSWCLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCCCC(=O)O)Cl |
Computed by PubChem (NCBI)