CAS 119424-90-7 is the registry number for Ethyl 3-(2,6-dichlorophenyl)-2-methylprop-2-enoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl (E)-3-(2,6-dichlorophenyl)-2-methylprop-2-enoate (CAS 119424-90-7) is a chemical compound with the molecular formula C12H12Cl2O2 and a molecular weight of 259.12 g/mol. IUPAC name: ethyl (E)-3-(2,6-dichlorophenyl)-2-methylprop-2-enoate. InChIKey: YUGSBHRZJHUFOR-BQYQJAHWSA-N.
| Molecular formula | C12H12Cl2O2 |
|---|---|
| Molecular weight | 259.12 g/mol |
| IUPAC name | ethyl (E)-3-(2,6-dichlorophenyl)-2-methylprop-2-enoate |
| InChIKey | YUGSBHRZJHUFOR-BQYQJAHWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=C(C=CC=C1Cl)Cl)/C |
Computed by PubChem (NCBI)