CAS 61023-76-5 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)cyclopentanecarboxylic acid, 1-(2,4-Dichlorophenyl)cyclopentane-1-carboxylic acid, >95%, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 5g.
1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid (CAS 61023-76-5) is a chemical compound with the molecular formula C12H12Cl2O2 and a molecular weight of 259.12 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: CJVNUENSNUSROF-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O2 |
|---|---|
| Molecular weight | 259.12 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | CJVNUENSNUSROF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)