CAS 437650-06-1 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-cyclopentanecarboxylic acid, 98%, 1-(3,4-Dichlorophenyl)cyclopentanecarboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
1-(3,4-dichlorophenyl)cyclopentane-1-carboxylic acid (CAS 437650-06-1) is a chemical compound with the molecular formula C12H12Cl2O2 and a molecular weight of 259.12 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: JYVJTQGEWALLOO-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O2 |
|---|---|
| Molecular weight | 259.12 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | JYVJTQGEWALLOO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)