CAS 119435-90-4 is the registry number for 6-(Bromomethyl)-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg.
6-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 119435-90-4) is a chemical compound with the molecular formula C15H21Br and a molecular weight of 281.23 g/mol. IUPAC name: 6-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: YRSSLQXZDTXEBD-UHFFFAOYSA-N.
| Molecular formula | C15H21Br |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | 6-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | YRSSLQXZDTXEBD-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)CBr)(C)C)C |
Computed by PubChem (NCBI)