CAS 119999-22-3 appears in our catalog under these names: 6–Bromo–1,1,4,4,7–pentamethyl–1,2,3,4–tetrahydronaphthalene, 6-Bromo-1,1,4,4,7-pentamethyl-1,2,3,4-tetrahydronaphthalene, 6-Bromo-1,1,4,4,7-pentamethyl-1,2,3,4-tetrahydronaphthalene, 98%, 98%, 6-Bromo-1,1,4,4,7-pentamethyl-1,2,3,4-tetrahydro-naphthalene, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 100g, 1g.
6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (CAS 119999-22-3) is a chemical compound with the molecular formula C15H21Br and a molecular weight of 281.23 g/mol. IUPAC name: 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene. InChIKey: ONNHBALCPUEXBT-UHFFFAOYSA-N.
| Molecular formula | C15H21Br |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
| InChIKey | ONNHBALCPUEXBT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)