CAS 1562418-80-7 is the registry number for 5-Bromo-1,1,2,2,3,3-hexamethyl-2,3-dihydro-1H-indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1,1,2,2,3,3-hexamethylindene (CAS 1562418-80-7) is a chemical compound with the molecular formula C15H21Br and a molecular weight of 281.23 g/mol. IUPAC name: 5-bromo-1,1,2,2,3,3-hexamethylindene. InChIKey: FECNLRGSKHAKIM-UHFFFAOYSA-N.
| Molecular formula | C15H21Br |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | 5-bromo-1,1,2,2,3,3-hexamethylindene |
| InChIKey | FECNLRGSKHAKIM-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)C(C1(C)C)(C)C)C |
Computed by PubChem (NCBI)