Products 119438-13-0

CAS 119438-13-0 is the registry number for 1-(2,5-Dichlorophenyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-(2,5-dichlorophenyl)piperazine;hydrochloride (CAS 119438-13-0) is a chemical compound with the molecular formula C10H13Cl3N2 and a molecular weight of 267.6 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)piperazine;hydrochloride. InChIKey: LHJNEDCRXXPMKC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13Cl3N2
Molecular weight267.6 g/mol
IUPAC name1-(2,5-dichlorophenyl)piperazine;hydrochloride
InChIKeyLHJNEDCRXXPMKC-UHFFFAOYSA-N
SMILESC1CN(CCN1)C2=C(C=CC(=C2)Cl)Cl.Cl

Computed by PubChem (NCBI)