CAS 119438-13-0 is the registry number for 1-(2,5-Dichlorophenyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 10g.
1-(2,5-dichlorophenyl)piperazine;hydrochloride (CAS 119438-13-0) is a chemical compound with the molecular formula C10H13Cl3N2 and a molecular weight of 267.6 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)piperazine;hydrochloride. InChIKey: LHJNEDCRXXPMKC-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl3N2 |
|---|---|
| Molecular weight | 267.6 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)piperazine;hydrochloride |
| InChIKey | LHJNEDCRXXPMKC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)