CAS 119532-26-2 appears in our catalog under these names: N-(2,3-Dichlorophenyl)piperazine hydroch, loride, 2 kg, N-(2,3-Dichlorophenyl)piperazine hydroch, loride, 250 g, Aripiprazole EP Impurity B HCl, N-(2,3-Dichlorophenyl)piperazine Hydrochloride, >95% (HPLC), 1-(2,3-Dichlorophenyl)piperazine Hydrochloride. Offered by: Roth, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 2kg, 250g, on request, 100mg, 500mg, 50mg, 25mg, 10mg.
1-(2,3-dichlorophenyl)piperazine;hydrochloride (CAS 119532-26-2) is a chemical compound with the molecular formula C10H13Cl3N2 and a molecular weight of 267.6 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)piperazine;hydrochloride. InChIKey: CYQFNNSFAGXCEC-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl3N2 |
|---|---|
| Molecular weight | 267.6 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)piperazine;hydrochloride |
| InChIKey | CYQFNNSFAGXCEC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)