CAS 2514942-62-0 is the registry number for N1-(2-Chloroethyl)-N2-(2,3-dichlorophenyl)ethane-1,2-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloroethyl)-N'-(2,3-dichlorophenyl)ethane-1,2-diamine (CAS 2514942-62-0) is a chemical compound with the molecular formula C10H13Cl3N2 and a molecular weight of 267.6 g/mol. IUPAC name: N-(2-chloroethyl)-N'-(2,3-dichlorophenyl)ethane-1,2-diamine. InChIKey: LHXWBJVFGUQGPK-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl3N2 |
|---|---|
| Molecular weight | 267.6 g/mol |
| IUPAC name | N-(2-chloroethyl)-N'-(2,3-dichlorophenyl)ethane-1,2-diamine |
| InChIKey | LHXWBJVFGUQGPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NCCNCCCl |
Computed by PubChem (NCBI)