Products 1194826-85-1
CAS 1194826-85-1 is the registry number for (2Z)-3-(3-Aminophenyl)-2-propenoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
(Z)-3-(3-aminophenyl)prop-2-enoic acid (CAS 1194826-85-1) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (Z)-3-(3-aminophenyl)prop-2-enoic acid. InChIKey: JNXMJSYJCFTLJB-PLNGDYQASA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (Z)-3-(3-aminophenyl)prop-2-enoic acid |
| InChIKey | JNXMJSYJCFTLJB-PLNGDYQASA-N |
| SMILES | C1=CC(=CC(=C1)N)/C=C\C(=O)O |
Computed by PubChem (NCBI)