CAS 1195782-28-5 appears in our catalog under these names: (2r,6s)-Rel-1,2,6-trimethylpiperazine dihydrochloride, 98%, (2R,6S)-rel-1,2,6-Trimethylpiperazine dihydrochloride, 97%, (2R,6S)-rel-1,2,6-TriMethylpiperazine dihydrochloride, 97%, 97%, cis-1,2,6-Trimethylpiperazine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
(2R,6S)-1,2,6-trimethylpiperazine;dihydrochloride (CAS 1195782-28-5) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2R,6S)-1,2,6-trimethylpiperazine;dihydrochloride. InChIKey: SZLULMXLBYGMPO-DTQHMAPFSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2R,6S)-1,2,6-trimethylpiperazine;dihydrochloride |
| InChIKey | SZLULMXLBYGMPO-DTQHMAPFSA-N |
| SMILES | C[C@@H]1CNC[C@@H](N1C)C.Cl.Cl |
Computed by PubChem (NCBI)