CAS 2126143-54-0 appears in our catalog under these names: (2R,6R)-1,2,6-Trimethylpiperazine dihydrochloride, 95%, (2R,6R)-1,2,6-trimethylpiperazine dihydrochloride, 97%, (2R,6R)-1,2,6-Trimethylpiperazine dihydrochloride, (2R,6R)-1,2,6-trimethylpiperazine,dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 50mg, 500mg.
(2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride (CAS 2126143-54-0) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride. InChIKey: SZLULMXLBYGMPO-GPJOBVNKSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride |
| InChIKey | SZLULMXLBYGMPO-GPJOBVNKSA-N |
| SMILES | C[C@@H]1CNC[C@H](N1C)C.Cl.Cl |
Computed by PubChem (NCBI)