CAS 2102409-62-9 is the registry number for trans-1,2,6-Trimethylpiperazine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride (CAS 2102409-62-9) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride. InChIKey: SZLULMXLBYGMPO-GPJOBVNKSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2R,6R)-1,2,6-trimethylpiperazine;dihydrochloride |
| InChIKey | SZLULMXLBYGMPO-GPJOBVNKSA-N |
| SMILES | C[C@@H]1CNC[C@H](N1C)C.Cl.Cl |
Computed by PubChem (NCBI)