Products 119584-74-6
CAS 119584-74-6 is the registry number for 2-Fluoro-6-(2,2,2-trifluoroethoxy)benzonitrile, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2-fluoro-6-(2,2,2-trifluoroethoxy)benzonitrile (CAS 119584-74-6) is a chemical compound with the molecular formula C9H5F4NO and a molecular weight of 219.14 g/mol. IUPAC name: 2-fluoro-6-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: KPUXDDKZMLVAEI-UHFFFAOYSA-N.
| Molecular formula | C9H5F4NO |
|---|---|
| Molecular weight | 219.14 g/mol |
| IUPAC name | 2-fluoro-6-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | KPUXDDKZMLVAEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)