CAS 1208977-14-3 is the registry number for 7-Fluoro-4-trifluoromethoxy-1H-indole. Offered by: TRC. Available pack sizes: 250mg.
7-fluoro-4-(trifluoromethoxy)-1H-indole (CAS 1208977-14-3) is a chemical compound with the molecular formula C9H5F4NO and a molecular weight of 219.14 g/mol. IUPAC name: 7-fluoro-4-(trifluoromethoxy)-1H-indole. InChIKey: KTPUBEFBWBWPFI-UHFFFAOYSA-N.
| Molecular formula | C9H5F4NO |
|---|---|
| Molecular weight | 219.14 g/mol |
| IUPAC name | 7-fluoro-4-(trifluoromethoxy)-1H-indole |
| InChIKey | KTPUBEFBWBWPFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1OC(F)(F)F)C=CN2)F |
Computed by PubChem (NCBI)