CAS 1499400-23-5 is the registry number for 2-Fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile (CAS 1499400-23-5) is a chemical compound with the molecular formula C9H5F4NO and a molecular weight of 219.14 g/mol. IUPAC name: 2-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: POCRQWFKJKBFEK-UHFFFAOYSA-N.
| Molecular formula | C9H5F4NO |
|---|---|
| Molecular weight | 219.14 g/mol |
| IUPAC name | 2-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | POCRQWFKJKBFEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)F)C#N |
Computed by PubChem (NCBI)