CAS 1195901-99-5 is the registry number for 4-Methyl-4-p-tolyl-4,5,6,7-tetrahydro-3h-imidazo[4,5-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-methyl-4-(4-methylphenyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine (CAS 1195901-99-5) is a chemical compound with the molecular formula C14H17N3 and a molecular weight of 227.30 g/mol. IUPAC name: 4-methyl-4-(4-methylphenyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine. InChIKey: NHQPRGUGLSNRBS-UHFFFAOYSA-N.
| Molecular formula | C14H17N3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 4-methyl-4-(4-methylphenyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| InChIKey | NHQPRGUGLSNRBS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C3=C(CCN2)NC=N3)C |
Computed by PubChem (NCBI)