CAS 313505-80-5 is the registry number for 4-tert-Butyl-6-phenyl-2-pyrimidinamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-tert-butyl-6-phenylpyrimidin-2-amine (CAS 313505-80-5) is a chemical compound with the molecular formula C14H17N3 and a molecular weight of 227.30 g/mol. IUPAC name: 4-tert-butyl-6-phenylpyrimidin-2-amine. InChIKey: WRUMWHKCNMJMLF-UHFFFAOYSA-N.
| Molecular formula | C14H17N3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 4-tert-butyl-6-phenylpyrimidin-2-amine |
| InChIKey | WRUMWHKCNMJMLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)