CAS 2097360-84-2 is the registry number for (R)-1-(o-Tolyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine (CAS 2097360-84-2) is a chemical compound with the molecular formula C14H17N3 and a molecular weight of 227.30 g/mol. IUPAC name: (4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine. InChIKey: LAKUHVDPKSNZTH-GFCCVEGCSA-N.
| Molecular formula | C14H17N3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine |
| InChIKey | LAKUHVDPKSNZTH-GFCCVEGCSA-N |
| SMILES | CC1=CC=CC=C1N2C3=C(C=N2)[C@@H](CCC3)N |
Computed by PubChem (NCBI)