Products 1196037-60-1
CAS 1196037-60-1 is the registry number for tert-Butyl (S)-(7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate (CAS 1196037-60-1) is a chemical compound with the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. IUPAC name: tert-butyl N-[(2S)-7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate. InChIKey: BKXWWJYMDCEAKU-JTQLQIEISA-N.
| Molecular formula | C16H19BrN2O2 |
|---|---|
| Molecular weight | 351.24 g/mol |
| IUPAC name | tert-butyl N-[(2S)-7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate |
| InChIKey | BKXWWJYMDCEAKU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC2=C(C1)NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)