CAS 1234685-60-9 is the registry number for tert-Butyl 8-bromo-1,3,4,5-tetrahydro-2h-pyrido[4,3-b]indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
Tert-butyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (CAS 1234685-60-9) is a chemical compound with the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. IUPAC name: tert-butyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: MRQKNQKVVBOWKU-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2O2 |
|---|---|
| Molecular weight | 351.24 g/mol |
| IUPAC name | tert-butyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| InChIKey | MRQKNQKVVBOWKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)