CAS 2924063-70-5 is the registry number for GPR183-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-bromophenyl)-1-[4-(oxetan-3-yl)piperazin-1-yl]prop-2-en-1-one (CAS 2924063-70-5) is a chemical compound with the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. IUPAC name: (E)-3-(4-bromophenyl)-1-[4-(oxetan-3-yl)piperazin-1-yl]prop-2-en-1-one. InChIKey: NSJKIFRBTRWMMT-ZZXKWVIFSA-N.
| Molecular formula | C16H19BrN2O2 |
|---|---|
| Molecular weight | 351.24 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)-1-[4-(oxetan-3-yl)piperazin-1-yl]prop-2-en-1-one |
| InChIKey | NSJKIFRBTRWMMT-ZZXKWVIFSA-N |
| SMILES | C1CN(CCN1C2COC2)C(=O)/C=C/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)