Products 1196157-80-8
CAS 1196157-80-8 appears in our catalog under these names: Sulfamerazine 13C6 (phenyl 13C6), Sulfamerazine-13C6, 13C6-Sulfamerazine, ISO 17034 RM, 13C6-Sulfamerazine, 100 µg/ml in Methanol, ISO 17034 CRM, Sulfamerazin-13C6. Offered by: Dr. Ehrenstorfer, TRC, MedChemExpress, HPC Standards, Sigma-Aldrich. Available pack sizes: 10mg, 100mg, 10 mg, 5 mg, 1 mg, 1ml.
4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (CAS 1196157-80-8) is a chemical compound with the molecular formula C11H12N4O2S and a molecular weight of 270.26 g/mol. IUPAC name: 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide. InChIKey: QPPBRPIAZZHUNT-PBZDKDNVSA-N.
| Molecular formula | C11H12N4O2S |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChIKey | QPPBRPIAZZHUNT-PBZDKDNVSA-N |
| SMILES | CC1=NC(=NC=C1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N |
Computed by PubChem (NCBI)