CAS 330956-99-5 appears in our catalog under these names: 6-Nitro-2-piperazin-1-yl-1,3-benzothiazole hydrochloride, 95%, 6-Nitro-2-piperazin-1-yl-benzothiazole, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
6-nitro-2-piperazin-1-yl-1,3-benzothiazole (CAS 330956-99-5) is a chemical compound with the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. IUPAC name: 6-nitro-2-piperazin-1-yl-1,3-benzothiazole. InChIKey: RBZWYLUVTPLLOU-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2S |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | 6-nitro-2-piperazin-1-yl-1,3-benzothiazole |
| InChIKey | RBZWYLUVTPLLOU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(S2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)