CAS 2135339-91-0 is the registry number for N2-[2-(Methylsulfonyl)phenyl]pyrimidine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-N-(2-methylsulfonylphenyl)pyrimidine-2,4-diamine (CAS 2135339-91-0) is a chemical compound with the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. IUPAC name: 2-N-(2-methylsulfonylphenyl)pyrimidine-2,4-diamine. InChIKey: ALOZSGHCNGPDMN-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2S |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | 2-N-(2-methylsulfonylphenyl)pyrimidine-2,4-diamine |
| InChIKey | ALOZSGHCNGPDMN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1NC2=NC=CC(=N2)N |
Computed by PubChem (NCBI)