CAS 119639-24-6 appears in our catalog under these names: 2-​(1,​1-​Dimethylethyl)​-3(2H)​-​isothiazolone 1,​1-​dioxide, 2-(tert-Butyl)isothiazol-3(2H)-one 1,1-dioxide, 97+%, 97+%, 2-(tert-Butyl)isothiazol-3(2H)-one1,1-dioxide, 97+%, 2-(tert-Butyl)isothiazol-3(2H)-one 1,1-dioxide, 97+%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one (CAS 119639-24-6) is a chemical compound with the molecular formula C7H11NO3S and a molecular weight of 189.23 g/mol. IUPAC name: 2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one. InChIKey: ACMFJQJWCFZWEU-UHFFFAOYSA-N.
| Molecular formula | C7H11NO3S |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | 2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one |
| InChIKey | ACMFJQJWCFZWEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C=CS1(=O)=O |
Computed by PubChem (NCBI)