Products 119644-16-5
CAS 119644-16-5 is the registry number for 3-Methyl-3-butenyl (E)-Caffeate. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methylbut-3-enyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 119644-16-5) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 3-methylbut-3-enyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: APFXJJMDUXKKAG-GQCTYLIASA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 3-methylbut-3-enyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | APFXJJMDUXKKAG-GQCTYLIASA-N |
| SMILES | CC(=C)CCOC(=O)/C=C/C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)