CAS 1196474-68-6 appears in our catalog under these names: Ethyl 4-(3-bromo-4-formylphenoxy)benzoate, 95%, Ethyl 4–(3–bromo–4–formylphenoxy)benzoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 4-(3-bromo-4-formylphenoxy)benzoate (CAS 1196474-68-6) is a chemical compound with the molecular formula C16H13BrO4 and a molecular weight of 349.17 g/mol. IUPAC name: ethyl 4-(3-bromo-4-formylphenoxy)benzoate. InChIKey: ZETWHASWJSGZSB-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO4 |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | ethyl 4-(3-bromo-4-formylphenoxy)benzoate |
| InChIKey | ZETWHASWJSGZSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)OC2=CC(=C(C=C2)C=O)Br |
Computed by PubChem (NCBI)