CAS 692266-89-0 is the registry number for 5-Bromo-2-ethoxy-4-formylphenyl benzoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(5-bromo-2-ethoxy-4-formylphenyl) benzoate (CAS 692266-89-0) is a chemical compound with the molecular formula C16H13BrO4 and a molecular weight of 349.17 g/mol. IUPAC name: (5-bromo-2-ethoxy-4-formylphenyl) benzoate. InChIKey: ZHZFXEHWWZGDKU-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO4 |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | (5-bromo-2-ethoxy-4-formylphenyl) benzoate |
| InChIKey | ZHZFXEHWWZGDKU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Br)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)