Products 214221-82-6
CAS 214221-82-6 is the registry number for SARS-CoV-2-IN-84. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl]-5-methylcyclohexa-2,5-diene-1,4-dione (CAS 214221-82-6) is a chemical compound with the molecular formula C16H13BrO4 and a molecular weight of 349.17 g/mol. IUPAC name: 2-[3-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl]-5-methylcyclohexa-2,5-diene-1,4-dione. InChIKey: KQVIOKFXOUYHMB-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO4 |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | 2-[3-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl]-5-methylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | KQVIOKFXOUYHMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=CC1=O)CCCC2=CC(=O)C(=CC2=O)Br |
Computed by PubChem (NCBI)