Products 1196699-78-1

CAS 1196699-78-1 is the registry number for 5-Chloro-2-propoxypyridin-4-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(5-chloro-2-propoxy-4-pyridinyl)boronic acid (CAS 1196699-78-1) is a chemical compound with the molecular formula C8H11BClNO3 and a molecular weight of 215.44 g/mol. IUPAC name: (5-chloro-2-propoxy-4-pyridinyl)boronic acid. InChIKey: JOHIMZQPTGASTM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BClNO3
Molecular weight215.44 g/mol
IUPAC name(5-chloro-2-propoxy-4-pyridinyl)boronic acid
InChIKeyJOHIMZQPTGASTM-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1Cl)OCCC)(O)O

Computed by PubChem (NCBI)