CAS 1217501-41-1 appears in our catalog under these names: 5-Chloro-2-isopropoxypyridine-3-boronic acid, 96%, (5-Chloro-2-isopropoxypyridin-3-yl)boronic acid 96%, 5-Chloro-2-isopropoxypyridine-3-boronic acid, 96%, 96%, (5-Chloro-2-isopropoxypyridin-3-yl)boronic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(5-chloro-2-propan-2-yloxy-3-pyridinyl)boronic acid (CAS 1217501-41-1) is a chemical compound with the molecular formula C8H11BClNO3 and a molecular weight of 215.44 g/mol. IUPAC name: (5-chloro-2-propan-2-yloxy-3-pyridinyl)boronic acid. InChIKey: NMVYPCNDMPTZQR-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO3 |
|---|---|
| Molecular weight | 215.44 g/mol |
| IUPAC name | (5-chloro-2-propan-2-yloxy-3-pyridinyl)boronic acid |
| InChIKey | NMVYPCNDMPTZQR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)