CAS 2096341-56-7 appears in our catalog under these names: 3-Chloro-2-propoxypyridine-4-boronic acid, 98%, (3-Chloro-2-propoxypyridin-4-yl)boronic acid 97%, 3-Chloro-2-propoxypyridine-4-boronic acid, 97%, 97%, 3-Chloro-2-propoxypyridine-4-boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-chloro-2-propoxy-4-pyridinyl)boronic acid (CAS 2096341-56-7) is a chemical compound with the molecular formula C8H11BClNO3 and a molecular weight of 215.44 g/mol. IUPAC name: (3-chloro-2-propoxy-4-pyridinyl)boronic acid. InChIKey: ZJVIKLLXTWGQPM-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO3 |
|---|---|
| Molecular weight | 215.44 g/mol |
| IUPAC name | (3-chloro-2-propoxy-4-pyridinyl)boronic acid |
| InChIKey | ZJVIKLLXTWGQPM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OCCC)Cl)(O)O |
Computed by PubChem (NCBI)