Products 1197193-33-1
CAS 1197193-33-1 appears in our catalog under these names: 3-Chloro-4-(4-methyl-1-piperazinyl)benzoic acid, 97%, 3–Chloro–4–(4–methyl–1–piperazinyl)benzoic Acid, 3-Chloro-4-(4-methyl-1-piperazinyl)benzoic Acid, ≥95%, ≥95%, 3-Chloro-4-(4-methyl-1-piperazinyl)benzoic Acid, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg.
3-chloro-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 1197193-33-1) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 3-chloro-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: RSSBUWGQOMUQJI-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 3-chloro-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | RSSBUWGQOMUQJI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)