Products 1197193-44-4
CAS 1197193-44-4 appears in our catalog under these names: 4–Chloro–2–(4–methyl–1–piperazinyl)benzoic Acid, 4-Chloro-2-(4-methylpiperazin-1-yl)benzoic acid, 95%, 4-Chloro-2-(4-methylpiperazin-1-yl)benzoic acid, ≥97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g.
4-chloro-2-(4-methylpiperazin-1-yl)benzoic acid (CAS 1197193-44-4) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 4-chloro-2-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: RQOFHWOTPWWXGY-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 4-chloro-2-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | RQOFHWOTPWWXGY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)