Products 1197232-85-1
CAS 1197232-85-1 is the registry number for 1-Pyridin-2-yl-ethylamine oxalate, 90%. Offered by: Fluorochem. Available pack sizes: 1g.
Oxalic acid;1-pyridin-2-ylethanamine (CAS 1197232-85-1) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: oxalic acid;1-pyridin-2-ylethanamine. InChIKey: JLXOHIUBCQVGGB-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | oxalic acid;1-pyridin-2-ylethanamine |
| InChIKey | JLXOHIUBCQVGGB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=N1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)