CAS 1197238-08-6 appears in our catalog under these names: 1-(2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)ethanamine oxalate, 97%, 1-(2,3-Dihydro-benzo[1,4]dioxin-6-yl)-ethylamine oxalate. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanamine;oxalic acid (CAS 1197238-08-6) is a chemical compound with the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanamine;oxalic acid. InChIKey: SJRGHCQOCNTAJW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanamine;oxalic acid |
| InChIKey | SJRGHCQOCNTAJW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCCO2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)