CAS 1269052-82-5 is the registry number for [1-(2,3-Dihydro-1,4-benzodioxin-2-yl)ethyl]amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine;oxalic acid (CAS 1269052-82-5) is a chemical compound with the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine;oxalic acid. InChIKey: VMLWAAALRXTOLN-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine;oxalic acid |
| InChIKey | VMLWAAALRXTOLN-UHFFFAOYSA-N |
| SMILES | CC(C1COC2=CC=CC=C2O1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)