Products 96181-47-4

CAS 96181-47-4 is the registry number for Pyridoxine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-4-oxobutanoic acid (CAS 96181-47-4) is a chemical compound with the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. IUPAC name: 4-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-4-oxobutanoic acid. InChIKey: OYIOYBMRNQHXPK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO6
Molecular weight269.25 g/mol
IUPAC name4-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-4-oxobutanoic acid
InChIKeyOYIOYBMRNQHXPK-UHFFFAOYSA-N
SMILESCC1=NC=C(C(=C1OC(=O)CCC(=O)O)CO)CO

Computed by PubChem (NCBI)