CAS 119738-50-0 is the registry number for 5-(4-Methoxyphenyl)pyrazinamine. Offered by: TRC. Available pack sizes: 500mg.
5-(4-methoxyphenyl)pyrazin-2-amine (CAS 119738-50-0) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 5-(4-methoxyphenyl)pyrazin-2-amine. InChIKey: FSYUUWJQSLZZLC-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)pyrazin-2-amine |
| InChIKey | FSYUUWJQSLZZLC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CN=C(C=N2)N |
Computed by PubChem (NCBI)