Products 1197458-91-5
CAS 1197458-91-5 is the registry number for 4-(4-(4-Nitrophenyl)piperazin-1-yl)phenyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[4-(4-nitrophenyl)piperazin-1-yl]phenyl] acetate (CAS 1197458-91-5) is a chemical compound with the molecular formula C18H19N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: [4-[4-(4-nitrophenyl)piperazin-1-yl]phenyl] acetate. InChIKey: QKULQLYKMSCJKP-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [4-[4-(4-nitrophenyl)piperazin-1-yl]phenyl] acetate |
| InChIKey | QKULQLYKMSCJKP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)N2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)