CAS 26400-34-0 appears in our catalog under these names: FA-Gly-Phe-NH2, FA–Gly–Phe–NH₂. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg.
(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanamide (CAS 26400-34-0) is a chemical compound with the molecular formula C18H19N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanamide. InChIKey: VWWNVBHNYLBUSY-HVHJFMEUSA-N.
| Molecular formula | C18H19N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanamide |
| InChIKey | VWWNVBHNYLBUSY-HVHJFMEUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)CNC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)