Products 1311136-84-1
CAS 1311136-84-1 appears in our catalog under these names: AUT1, (5R)-5-Ethyl-3-(6-(3-methoxy-4-methylphenoxy)-3-pyridinyl)-2,4-imidazolidinedione, AUT1/ 99.43% (existing batch purity), AUT1 99%, (5R)-5-Ethyl-3-[6-(3-methoxy-4-methylphenoxy)-3-pyridinyl]-2,4-imidazolidinedione, 99%, 99%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 1mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-3-pyridinyl]imidazolidine-2,4-dione (CAS 1311136-84-1) is a chemical compound with the molecular formula C18H19N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: (5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-3-pyridinyl]imidazolidine-2,4-dione. InChIKey: AMAOXEGBJHLCSF-CQSZACIVSA-N.
| Molecular formula | C18H19N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-3-pyridinyl]imidazolidine-2,4-dione |
| InChIKey | AMAOXEGBJHLCSF-CQSZACIVSA-N |
| SMILES | CC[C@@H]1C(=O)N(C(=O)N1)C2=CN=C(C=C2)OC3=CC(=C(C=C3)C)OC |
Computed by PubChem (NCBI)