Products 1197458-92-6

CAS 1197458-92-6 is the registry number for 4-(4-(4-Aminophenyl)piperazin-1-yl)phenyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[4-[4-(4-aminophenyl)piperazin-1-yl]phenyl] acetate (CAS 1197458-92-6) is a chemical compound with the molecular formula C18H21N3O2 and a molecular weight of 311.4 g/mol. IUPAC name: [4-[4-(4-aminophenyl)piperazin-1-yl]phenyl] acetate. InChIKey: MNBSTKZBQBRJGC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21N3O2
Molecular weight311.4 g/mol
IUPAC name[4-[4-(4-aminophenyl)piperazin-1-yl]phenyl] acetate
InChIKeyMNBSTKZBQBRJGC-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC=C(C=C1)N2CCN(CC2)C3=CC=C(C=C3)N

Computed by PubChem (NCBI)