Products 1956364-13-8

CAS 1956364-13-8 is the registry number for 3-(1-(5-Ethylpyrimidin-2-yl)piperidin-4-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]benzoic acid (CAS 1956364-13-8) is a chemical compound with the molecular formula C18H21N3O2 and a molecular weight of 311.4 g/mol. IUPAC name: 3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]benzoic acid. InChIKey: WXCMCUJGKPATDO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21N3O2
Molecular weight311.4 g/mol
IUPAC name3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]benzoic acid
InChIKeyWXCMCUJGKPATDO-UHFFFAOYSA-N
SMILESCCC1=CN=C(N=C1)N2CCC(CC2)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)