CAS 461430-15-9 is the registry number for 6-(3,4-Dimethoxyphenyl)-1,4,5,7-tetramethyl-6H-pyrrolo(3,4-d)pyridazine. Offered by: TRC. Available pack sizes: 25mg.
6-(3,4-dimethoxyphenyl)-1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazine (CAS 461430-15-9) is a chemical compound with the molecular formula C18H21N3O2 and a molecular weight of 311.4 g/mol. IUPAC name: 6-(3,4-dimethoxyphenyl)-1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazine. InChIKey: UXIXVNMARWQRED-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 6-(3,4-dimethoxyphenyl)-1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazine |
| InChIKey | UXIXVNMARWQRED-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN=C(C2=C(N1C3=CC(=C(C=C3)OC)OC)C)C)C |
Computed by PubChem (NCBI)