Products 1197533-86-0
CAS 1197533-86-0 is the registry number for (4-methyl-3-nitrophenyl)(thiomorpholino)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(4-methyl-3-nitrophenyl)-thiomorpholin-4-ylmethanone (CAS 1197533-86-0) is a chemical compound with the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. IUPAC name: (4-methyl-3-nitrophenyl)-thiomorpholin-4-ylmethanone. InChIKey: FLFUFHVBXATKHJ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | (4-methyl-3-nitrophenyl)-thiomorpholin-4-ylmethanone |
| InChIKey | FLFUFHVBXATKHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)N2CCSCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)