CAS 1197654-72-0 is the registry number for N-((4-Bromothiophen-2-yl)methyl)-N,3-dimethylisoxazole-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethyl-1,2-oxazole-5-carboxamide (CAS 1197654-72-0) is a chemical compound with the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. IUPAC name: N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethyl-1,2-oxazole-5-carboxamide. InChIKey: PGUBTTWCEFXLTM-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethyl-1,2-oxazole-5-carboxamide |
| InChIKey | PGUBTTWCEFXLTM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C(=O)N(C)CC2=CC(=CS2)Br |
Computed by PubChem (NCBI)